C18H19F3N4O2 — CID 122317868
N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-2-(trifluoromethoxy)benzamide (PubChem CID 122317868) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 122317868 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]-2-(trifluoromethoxy)benzamide |
| SMILES | Cc1cc(N2CCCC2)nc(CNC(=O)c2ccccc2OC(F)(F)F)n1 |
| InChI | InChI=1S/C18H19F3N4O2/c1-12-10-16(25-8-4-5-9-25)24-15(23-12)11-22-17(26)13-6-2-3-7-14(13)27-18(19,20)21/h2-3,6-7,10H,4-5,8-9,11H2,1H3,(H,22,26) |
| InChIKey | MJTNMQLUKZZFPP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |