C18H21ClFN5O2 — CID 121075261
2-chloro-4-fluoro-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzamide (PubChem CID 121075261) has the molecular formula C18H21ClFN5O2 and a molecular weight of 393.85 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121075261 |
| Molecular Formula | C18H21ClFN5O2 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-chloro-4-fluoro-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(N2CCOCC2)nc(NCCNC(=O)c2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C18H21ClFN5O2/c1-12-10-16(25-6-8-27-9-7-25)24-18(23-12)22-5-4-21-17(26)14-3-2-13(20)11-15(14)19/h2-3,10-11H,4-9H2,1H3,(H,21,26)(H,22,23,24) |
| InChIKey | QXJWWXCSHPQCFV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|