C20H25N7OS — CID 122294976
1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 122294976) has the molecular formula C20H25N7OS and a molecular weight of 411.54 g/mol. Its IUPAC name is 1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122294976 |
| Molecular Formula | C20H25N7OS |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNC(=O)c2cc(-c3cccs3)nn2C)n1 |
| InChI | InChI=1S/C20H25N7OS/c1-14-12-18(27-9-3-4-10-27)24-20(23-14)22-8-7-21-19(28)16-13-15(25-26(16)2)17-6-5-11-29-17/h5-6,11-13H,3-4,7-10H2,1-2H3,(H,21,28)(H,22,23,24) |
| InChIKey | IKUASXZVHLAQMW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|