C20H21N7OS — CID 122308676
1-methyl-N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 122308676) has the molecular formula C20H21N7OS and a molecular weight of 407.50 g/mol. Its IUPAC name is 1-methyl-N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122308676 |
| Molecular Formula | C20H21N7OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-methyl-N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2cc(-c3cccs3)nn2C)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C20H21N7OS/c1-14-23-18(13-19(24-14)27-9-3-4-10-27)21-7-8-22-20(28)16-12-15(25-26(16)2)17-6-5-11-29-17/h3-6,9-13H,7-8H2,1-2H3,(H,22,28)(H,21,23,24) |
| InChIKey | DJCBJSFIVBWBJS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|