C22H27N7O — CID 122293843
1-methyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-3-phenylpyrazole-5-carboxamide (PubChem CID 122293843) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 1-methyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-3-phenylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-3-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122293843 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-methyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-3-phenylpyrazole-5-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2cc(-c3ccccc3)nn2C)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C22H27N7O/c1-16-25-20(15-21(26-16)29-12-6-7-13-29)23-10-11-24-22(30)19-14-18(27-28(19)2)17-8-4-3-5-9-17/h3-5,8-9,14-15H,6-7,10-13H2,1-2H3,(H,24,30)(H,23,25,26) |
| InChIKey | PEIXBYCLYMGGPG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|