C18H27N7O — CID 122293924
1,3,5-trimethyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazole-4-carboxamide (PubChem CID 122293924) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122293924 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1,3,5-trimethyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazole-4-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2c(C)nn(C)c2C)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C18H27N7O/c1-12-17(13(2)24(4)23-12)18(26)20-8-7-19-15-11-16(22-14(3)21-15)25-9-5-6-10-25/h11H,5-10H2,1-4H3,(H,20,26)(H,19,21,22) |
| InChIKey | IFGSAMFEGIIHKR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|