C18H25N5O2 — CID 122293871
2,5-dimethyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]furan-3-carboxamide (PubChem CID 122293871) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 122293871 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2,5-dimethyl-N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]furan-3-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2cc(C)oc2C)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C18H25N5O2/c1-12-10-15(13(2)25-12)18(24)20-7-6-19-16-11-17(22-14(3)21-16)23-8-4-5-9-23/h10-11H,4-9H2,1-3H3,(H,20,24)(H,19,21,22) |
| InChIKey | OFUQYPFUSPSMSA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|