C19H29N7O — CID 122326520
1,3,5-trimethyl-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazole-4-carboxamide (PubChem CID 122326520) has the molecular formula C19H29N7O and a molecular weight of 371.49 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122326520 |
| Molecular Formula | C19H29N7O |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 1,3,5-trimethyl-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazole-4-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2c(C)nn(C)c2C)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C19H29N7O/c1-13-18(14(2)25(4)24-13)19(27)21-9-8-20-16-12-17(23-15(3)22-16)26-10-6-5-7-11-26/h12H,5-11H2,1-4H3,(H,21,27)(H,20,22,23) |
| InChIKey | KPJAGJVVYGQFAG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|