C23H24N8O — CID 122315086
1-methyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-3-phenylpyrazole-5-carboxamide (PubChem CID 122315086) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is 1-methyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-3-phenylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-3-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122315086 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-methyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-3-phenylpyrazole-5-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2cc(-c3ccccc3)nn2C)cc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C23H24N8O/c1-16-27-21(15-22(28-16)29-20-10-6-7-11-24-20)25-12-13-26-23(32)19-14-18(30-31(19)2)17-8-4-3-5-9-17/h3-11,14-15H,12-13H2,1-2H3,(H,26,32)(H2,24,25,27,28,29) |
| InChIKey | FRKOHHIUTBZMIR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|