C25H27N7O2 — CID 122294613
N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyl-3-phenylpyrazole-5-carboxamide (PubChem CID 122294613) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyl-3-phenylpyrazole-5-carboxamide.
| Compound Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyl-3-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122294613 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-methyl-3-phenylpyrazole-5-carboxamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)c3cc(-c4ccccc4)nn3C)n2)cc1 |
| InChI | InChI=1S/C25H27N7O2/c1-17-15-23(29-19-9-11-20(34-3)12-10-19)30-25(28-17)27-14-13-26-24(33)22-16-21(31-32(22)2)18-7-5-4-6-8-18/h4-12,15-16H,13-14H2,1-3H3,(H,26,33)(H2,27,28,29,30) |
| InChIKey | CQCRNZMRAAFKSL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|