C20H24FN7O — CID 122324623
N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide (PubChem CID 122324623) has the molecular formula C20H24FN7O and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122324623 |
| Molecular Formula | C20H24FN7O |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3-(4-fluorophenyl)-1-methylpyrazole-5-carboxamide |
| SMILES | CCNc1cc(C)nc(NCCNC(=O)c2cc(-c3ccc(F)cc3)nn2C)n1 |
| InChI | InChI=1S/C20H24FN7O/c1-4-22-18-11-13(2)25-20(26-18)24-10-9-23-19(29)17-12-16(27-28(17)3)14-5-7-15(21)8-6-14/h5-8,11-12H,4,9-10H2,1-3H3,(H,23,29)(H2,22,24,25,26) |
| InChIKey | WPLPOYRLZYLDPW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|