C22H21FN8O — CID 122289126
3-(4-fluorophenyl)-1-methyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]pyrazole-5-carboxamide (PubChem CID 122289126) has the molecular formula C22H21FN8O and a molecular weight of 432.46 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-methyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-1-methyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122289126 |
| Molecular Formula | C22H21FN8O |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-(4-fluorophenyl)-1-methyl-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]pyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccc(F)cc2)cc1C(=O)NCCNc1ccc(Nc2ccncc2)nn1 |
| InChI | InChI=1S/C22H21FN8O/c1-31-19(14-18(30-31)15-2-4-16(23)5-3-15)22(32)26-13-12-25-20-6-7-21(29-28-20)27-17-8-10-24-11-9-17/h2-11,14H,12-13H2,1H3,(H,25,28)(H,26,32)(H,24,27,29) |
| InChIKey | NSQOWPSLJFIWGM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|