C19H19FN6O — CID 121065151
2-(4-fluorophenyl)-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]acetamide (PubChem CID 121065151) has the molecular formula C19H19FN6O and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 121065151 |
| Molecular Formula | C19H19FN6O |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)NCCNc1ccc(Nc2ccncc2)nn1 |
| InChI | InChI=1S/C19H19FN6O/c20-15-3-1-14(2-4-15)13-19(27)23-12-11-22-17-5-6-18(26-25-17)24-16-7-9-21-10-8-16/h1-10H,11-13H2,(H,22,25)(H,23,27)(H,21,24,26) |
| InChIKey | HAKPLKAPKZCNPZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|