C16H16N6OS — CID 122289061
N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]thiophene-3-carboxamide (PubChem CID 122289061) has the molecular formula C16H16N6OS and a molecular weight of 340.41 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122289061 |
| Molecular Formula | C16H16N6OS |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[2-[[6-(pyridin-4-ylamino)pyridazin-3-yl]amino]ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCNc1ccc(Nc2ccncc2)nn1)c1ccsc1 |
| InChI | InChI=1S/C16H16N6OS/c23-16(12-5-10-24-11-12)19-9-8-18-14-1-2-15(22-21-14)20-13-3-6-17-7-4-13/h1-7,10-11H,8-9H2,(H,18,21)(H,19,23)(H,17,20,22) |
| InChIKey | FRVCGZRPWVXWLG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|