C12H12N2O2S2 — CID 101004058
N-[2-(thiophene-3-carbonylamino)ethyl]thiophene-3-carboxamide (PubChem CID 101004058) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[2-(thiophene-3-carbonylamino)ethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-(thiophene-3-carbonylamino)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 101004058 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N-[2-(thiophene-3-carbonylamino)ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C12H12N2O2S2/c15-11(9-1-5-17-7-9)13-3-4-14-12(16)10-2-6-18-8-10/h1-2,5-8H,3-4H2,(H,13,15)(H,14,16) |
| InChIKey | WNEZTKZOMIUKSY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|