C13H22ClN3O2S — CID 119506031
N-[4-[2-(ethylamino)ethylamino]-4-oxobutyl]thiophene-3-carboxamide;hydrochloride (PubChem CID 119506031) has the molecular formula C13H22ClN3O2S and a molecular weight of 319.86 g/mol. Its IUPAC name is N-[4-[2-(ethylamino)ethylamino]-4-oxobutyl]thiophene-3-carboxamide;hydrochloride.
| Compound Name | N-[4-[2-(ethylamino)ethylamino]-4-oxobutyl]thiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119506031 |
| Molecular Formula | C13H22ClN3O2S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[4-[2-(ethylamino)ethylamino]-4-oxobutyl]thiophene-3-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)CCCNC(=O)c1ccsc1.Cl |
| InChI | InChI=1S/C13H21N3O2S.ClH/c1-2-14-7-8-15-12(17)4-3-6-16-13(18)11-5-9-19-10-11;/h5,9-10,14H,2-4,6-8H2,1H3,(H,15,17)(H,16,18);1H |
| InChIKey | QSBZYNKOBHDZOK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|