C17H20N2O2S — CID 18108696
N-[4-oxo-4-(2-phenylethylamino)butyl]thiophene-3-carboxamide (PubChem CID 18108696) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[4-oxo-4-(2-phenylethylamino)butyl]thiophene-3-carboxamide.
| Compound Name | N-[4-oxo-4-(2-phenylethylamino)butyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18108696 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[4-oxo-4-(2-phenylethylamino)butyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)NCCc1ccccc1 |
| InChI | InChI=1S/C17H20N2O2S/c20-16(18-11-8-14-5-2-1-3-6-14)7-4-10-19-17(21)15-9-12-22-13-15/h1-3,5-6,9,12-13H,4,7-8,10-11H2,(H,18,20)(H,19,21) |
| InChIKey | RTTXZRXIMFKJFP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|