C15H14F2N2O2S — CID 51191676
N-[4-(2,6-difluoroanilino)-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 51191676) has the molecular formula C15H14F2N2O2S and a molecular weight of 324.35 g/mol. Its IUPAC name is N-[4-(2,6-difluoroanilino)-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-(2,6-difluoroanilino)-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 51191676 |
| Molecular Formula | C15H14F2N2O2S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[4-(2,6-difluoroanilino)-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H14F2N2O2S/c16-11-3-1-4-12(17)14(11)19-13(20)5-2-7-18-15(21)10-6-8-22-9-10/h1,3-4,6,8-9H,2,5,7H2,(H,18,21)(H,19,20) |
| InChIKey | GAMZJABJDPFUTG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|