C16H17FN2O2S — CID 27256783
N-[4-[(4-fluorophenyl)methylamino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 27256783) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[4-[(4-fluorophenyl)methylamino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[(4-fluorophenyl)methylamino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 27256783 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[4-[(4-fluorophenyl)methylamino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O2S/c17-14-5-3-12(4-6-14)10-19-15(20)2-1-8-18-16(21)13-7-9-22-11-13/h3-7,9,11H,1-2,8,10H2,(H,18,21)(H,19,20) |
| InChIKey | LDVHKTIXDZPUED-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|