C18H16FN3O2S2 — CID 30276571
N-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 30276571) has the molecular formula C18H16FN3O2S2 and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30276571 |
| Molecular Formula | C18H16FN3O2S2 |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C18H16FN3O2S2/c19-14-5-3-12(4-6-14)15-11-26-18(21-15)22-16(23)2-1-8-20-17(24)13-7-9-25-10-13/h3-7,9-11H,1-2,8H2,(H,20,24)(H,21,22,23) |
| InChIKey | XFEIOWLUTKCUIX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|