C14H10N2OS2 — CID 17417127
N-(4-phenyl-1,3-thiazol-2-yl)thiophene-3-carboxamide (PubChem CID 17417127) has the molecular formula C14H10N2OS2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)thiophene-3-carboxamide.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 17417127 |
| Molecular Formula | C14H10N2OS2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccsc1 |
| InChI | InChI=1S/C14H10N2OS2/c17-13(11-6-7-18-8-11)16-14-15-12(9-19-14)10-4-2-1-3-5-10/h1-9H,(H,15,16,17) |
| InChIKey | RPNIVCTXVFKQLH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |