C26H18N2OS — CID 3120660
N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-4-phenylbenzamide (PubChem CID 3120660) has the molecular formula C26H18N2OS and a molecular weight of 406.51 g/mol. Its IUPAC name is N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-4-phenylbenzamide.
| Compound Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 3120660 |
| Molecular Formula | C26H18N2OS |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-4-phenylbenzamide |
| SMILES | O=C(Nc1nc(-c2ccc3ccccc3c2)cs1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H18N2OS/c29-25(21-13-10-20(11-14-21)18-6-2-1-3-7-18)28-26-27-24(17-30-26)23-15-12-19-8-4-5-9-22(19)16-23/h1-17H,(H,27,28,29) |
| InChIKey | CPQNUIAYJCZTAE-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |