C33H21N5O2S2 — CID 4195615
2-N,6-N-bis(4-naphthalen-2-yl-1,3-thiazol-2-yl)pyridine-2,6-dicarboxamide (PubChem CID 4195615) has the molecular formula C33H21N5O2S2 and a molecular weight of 583.70 g/mol. Its IUPAC name is 2-N,6-N-bis(4-naphthalen-2-yl-1,3-thiazol-2-yl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(4-naphthalen-2-yl-1,3-thiazol-2-yl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 4195615 |
| Molecular Formula | C33H21N5O2S2 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | 2-N,6-N-bis(4-naphthalen-2-yl-1,3-thiazol-2-yl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1nc(-c2ccc3ccccc3c2)cs1)c1cccc(C(=O)Nc2nc(-c3ccc4ccccc4c3)cs2)n1 |
| InChI | InChI=1S/C33H21N5O2S2/c39-30(37-32-35-28(18-41-32)24-14-12-20-6-1-3-8-22(20)16-24)26-10-5-11-27(34-26)31(40)38-33-36-29(19-42-33)25-15-13-21-7-2-4-9-23(21)17-25/h1-19H,(H,35,37,39)(H,36,38,40) |
| InChIKey | OWOIFFHXZARODQ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |