C29H25N5O2S2 — CID 4653670
2-N,6-N-bis[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]pyridine-2,6-dicarboxamide (PubChem CID 4653670) has the molecular formula C29H25N5O2S2 and a molecular weight of 539.69 g/mol. Its IUPAC name is 2-N,6-N-bis[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 4653670 |
| Molecular Formula | C29H25N5O2S2 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 2-N,6-N-bis[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]pyridine-2,6-dicarboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3cccc(C(=O)Nc4nc(-c5ccc(C)c(C)c5)cs4)n3)n2)cc1C |
| InChI | InChI=1S/C29H25N5O2S2/c1-16-8-10-20(12-18(16)3)24-14-37-28(31-24)33-26(35)22-6-5-7-23(30-22)27(36)34-29-32-25(15-38-29)21-11-9-17(2)19(4)13-21/h5-15H,1-4H3,(H,31,33,35)(H,32,34,36) |
| InChIKey | CHTAXFKTMXYZNU-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |