C21H18N4OS2 — CID 46667849
N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 46667849) has the molecular formula C21H18N4OS2 and a molecular weight of 406.54 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46667849 |
| Molecular Formula | C21H18N4OS2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3c[nH]c(=S)n3-c3ccccc3)n2)cc1C |
| InChI | InChI=1S/C21H18N4OS2/c1-13-8-9-15(10-14(13)2)17-12-28-20(23-17)24-19(26)18-11-22-21(27)25(18)16-6-4-3-5-7-16/h3-12H,1-2H3,(H,22,27)(H,23,24,26) |
| InChIKey | XHOCWVLHWVJXOG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|