C16H14N4OS2 — CID 32867357
N-(4-cyclopropyl-1,3-thiazol-2-yl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 32867357) has the molecular formula C16H14N4OS2 and a molecular weight of 342.45 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 32867357 |
| Molecular Formula | C16H14N4OS2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)c1c[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C16H14N4OS2/c21-14(19-15-18-12(9-23-15)10-6-7-10)13-8-17-16(22)20(13)11-4-2-1-3-5-11/h1-5,8-10H,6-7H2,(H,17,22)(H,18,19,21) |
| InChIKey | GZROPRKICPJIHX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|