C15H13N3OS — CID 63718087
N-(4-cyclopropyl-1,3-thiazol-2-yl)-1H-indole-5-carboxamide (PubChem CID 63718087) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-1H-indole-5-carboxamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 63718087 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H13N3OS/c19-14(11-3-4-12-10(7-11)5-6-16-12)18-15-17-13(8-20-15)9-1-2-9/h3-9,16H,1-2H2,(H,17,18,19) |
| InChIKey | KXFBNIRLMLBNFS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |