C14H14N2O2S2 — CID 94198052
N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-[(R)-methylsulfinyl]benzamide (PubChem CID 94198052) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-[(R)-methylsulfinyl]benzamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-[(R)-methylsulfinyl]benzamide |
|---|---|
| PubChem CID | 94198052 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-[(R)-methylsulfinyl]benzamide |
| SMILES | C[S@@](=O)c1ccc(C(=O)Nc2nc(C3CC3)cs2)cc1 |
| InChI | InChI=1S/C14H14N2O2S2/c1-20(18)11-6-4-10(5-7-11)13(17)16-14-15-12(8-19-14)9-2-3-9/h4-9H,2-3H2,1H3,(H,15,16,17)/t20-/m1/s1 |
| InChIKey | QDXHTPJFXPAZFR-HXUWFJFHSA-N |
| XLogP | 3.01 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |