C20H18N4O2S2 — CID 32869371
1-N,4-N-bis(4-cyclopropyl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide (PubChem CID 32869371) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-N,4-N-bis(4-cyclopropyl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-cyclopropyl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 32869371 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 1-N,4-N-bis(4-cyclopropyl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)c1ccc(C(=O)Nc2nc(C3CC3)cs2)cc1 |
| InChI | InChI=1S/C20H18N4O2S2/c25-17(23-19-21-15(9-27-19)11-1-2-11)13-5-7-14(8-6-13)18(26)24-20-22-16(10-28-20)12-3-4-12/h5-12H,1-4H2,(H,21,23,25)(H,22,24,26) |
| InChIKey | AZPRQCRWIJOZJZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |