C12H10FN3OS — CID 54958473
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-fluoropyridine-4-carboxamide (PubChem CID 54958473) has the molecular formula C12H10FN3OS and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-fluoropyridine-4-carboxamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 54958473 |
| Molecular Formula | C12H10FN3OS |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-fluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)c1ccnc(F)c1 |
| InChI | InChI=1S/C12H10FN3OS/c13-10-5-8(3-4-14-10)11(17)16-12-15-9(6-18-12)7-1-2-7/h3-7H,1-2H2,(H,15,16,17) |
| InChIKey | KZDWMKMXCGPBIL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|