C15H9BrFN3OS — CID 60565091
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide (PubChem CID 60565091) has the molecular formula C15H9BrFN3OS and a molecular weight of 378.23 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 60565091 |
| Molecular Formula | C15H9BrFN3OS |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc(Br)c2)cs1)c1ccnc(F)c1 |
| InChI | InChI=1S/C15H9BrFN3OS/c16-11-3-1-2-9(6-11)12-8-22-15(19-12)20-14(21)10-4-5-18-13(17)7-10/h1-8H,(H,19,20,21) |
| InChIKey | IRHZJQQAARMUCW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|