C17H14FN3OS — CID 52733543
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide (PubChem CID 52733543) has the molecular formula C17H14FN3OS and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 52733543 |
| Molecular Formula | C17H14FN3OS |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)c3ccnc(F)c3)n2)cc1 |
| InChI | InChI=1S/C17H14FN3OS/c1-2-11-3-5-12(6-4-11)14-10-23-17(20-14)21-16(22)13-7-8-19-15(18)9-13/h3-10H,2H2,1H3,(H,20,21,22) |
| InChIKey | USKAGXXPUIYGDY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|