C18H12F4N2OS — CID 4637733
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 4637733) has the molecular formula C18H12F4N2OS and a molecular weight of 380.37 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 4637733 |
| Molecular Formula | C18H12F4N2OS |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)c3cc(F)c(F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C18H12F4N2OS/c1-2-9-3-5-10(6-4-9)13-8-26-18(23-13)24-17(25)11-7-12(19)15(21)16(22)14(11)20/h3-8H,2H2,1H3,(H,23,24,25) |
| InChIKey | GSGPIAAWCJRNBJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|