C19H14F4N2O2S — CID 16550455
2,3,4,5-tetrafluoro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 16550455) has the molecular formula C19H14F4N2O2S and a molecular weight of 410.39 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16550455 |
| Molecular Formula | C19H14F4N2O2S |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)c3cc(F)c(F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C19H14F4N2O2S/c1-2-7-27-11-5-3-10(4-6-11)14-9-28-19(24-14)25-18(26)12-8-13(20)16(22)17(23)15(12)21/h3-6,8-9H,2,7H2,1H3,(H,24,25,26) |
| InChIKey | YJCLGXVKAQFIKU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|