C17H15ClN2O3S — CID 39768846
5-chloro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]furan-2-carboxamide (PubChem CID 39768846) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is 5-chloro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39768846 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 5-chloro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]furan-2-carboxamide |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)c3ccc(Cl)o3)n2)cc1 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-2-9-22-12-5-3-11(4-6-12)13-10-24-17(19-13)20-16(21)14-7-8-15(18)23-14/h3-8,10H,2,9H2,1H3,(H,19,20,21) |
| InChIKey | FVTLKPQRYVUBGO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |