C24H28N2O3S — CID 4686613
3-pentoxy-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 4686613) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 3-pentoxy-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-pentoxy-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4686613 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-pentoxy-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCCOc1cccc(C(=O)Nc2nc(-c3ccc(OCCC)cc3)cs2)c1 |
| InChI | InChI=1S/C24H28N2O3S/c1-3-5-6-15-29-21-9-7-8-19(16-21)23(27)26-24-25-22(17-30-24)18-10-12-20(13-11-18)28-14-4-2/h7-13,16-17H,3-6,14-15H2,1-2H3,(H,25,26,27) |
| InChIKey | GGDNVSFPNBJEGX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|