C24H22N2O2S — CID 3524855
3-butoxy-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 3524855) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-butoxy-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-butoxy-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 3524855 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 3-butoxy-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2nc(-c3ccc4ccccc4c3)cs2)c1 |
| InChI | InChI=1S/C24H22N2O2S/c1-2-3-13-28-21-10-6-9-20(15-21)23(27)26-24-25-22(16-29-24)19-12-11-17-7-4-5-8-18(17)14-19/h4-12,14-16H,2-3,13H2,1H3,(H,25,26,27) |
| InChIKey | KOOWFEMHGXINLW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|