C22H24N2O2S — CID 3302590
4-butoxy-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 3302590) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-butoxy-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3302590 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-butoxy-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nc(-c3ccc(C)c(C)c3)cs2)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-4-5-12-26-19-10-8-17(9-11-19)21(25)24-22-23-20(14-27-22)18-7-6-15(2)16(3)13-18/h6-11,13-14H,4-5,12H2,1-3H3,(H,23,24,25) |
| InChIKey | FPRDLANIJQFYLQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|