C21H23N3O2S — CID 19224461
N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-4,6-dimethylpyridine-2-carboxamide (PubChem CID 19224461) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-4,6-dimethylpyridine-2-carboxamide.
| Compound Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-4,6-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 19224461 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-4,6-dimethylpyridine-2-carboxamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)c3cc(C)cc(C)n3)n2)cc1 |
| InChI | InChI=1S/C21H23N3O2S/c1-4-5-10-26-17-8-6-16(7-9-17)19-13-27-21(23-19)24-20(25)18-12-14(2)11-15(3)22-18/h6-9,11-13H,4-5,10H2,1-3H3,(H,23,24,25) |
| InChIKey | UELAYTRZUYSXHA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|