C20H19IN2O2S — CID 19197481
N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-iodobenzamide (PubChem CID 19197481) has the molecular formula C20H19IN2O2S and a molecular weight of 478.36 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-iodobenzamide.
| Compound Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 19197481 |
| Molecular Formula | C20H19IN2O2S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-2-iodobenzamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)c3ccccc3I)n2)cc1 |
| InChI | InChI=1S/C20H19IN2O2S/c1-2-3-12-25-15-10-8-14(9-11-15)18-13-26-20(22-18)23-19(24)16-6-4-5-7-17(16)21/h4-11,13H,2-3,12H2,1H3,(H,22,23,24) |
| InChIKey | RTBZJPIMDYLPJY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|