C18H16Br2N2O2S2 — CID 19197494
4,5-dibromo-N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]thiophene-2-carboxamide (PubChem CID 19197494) has the molecular formula C18H16Br2N2O2S2 and a molecular weight of 516.28 g/mol. Its IUPAC name is 4,5-dibromo-N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19197494 |
| Molecular Formula | C18H16Br2N2O2S2 |
| Molecular Weight | 516.28 g/mol |
| Exact Mass | 513.90 |
| IUPAC Name | 4,5-dibromo-N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)c3cc(Br)c(Br)s3)n2)cc1 |
| InChI | InChI=1S/C18H16Br2N2O2S2/c1-2-3-8-24-12-6-4-11(5-7-12)14-10-25-18(21-14)22-17(23)15-9-13(19)16(20)26-15/h4-7,9-10H,2-3,8H2,1H3,(H,21,22,23) |
| InChIKey | HXDHFJIBJHWFBO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.28 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|