C23H25BrN2O5S — CID 19195145
2-bromo-N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 19195145) has the molecular formula C23H25BrN2O5S and a molecular weight of 521.43 g/mol. Its IUPAC name is 2-bromo-N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | 2-bromo-N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 19195145 |
| Molecular Formula | C23H25BrN2O5S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 2-bromo-N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)c3cc(OC)c(OC)c(OC)c3Br)n2)cc1 |
| InChI | InChI=1S/C23H25BrN2O5S/c1-5-6-11-31-15-9-7-14(8-10-15)17-13-32-23(25-17)26-22(27)16-12-18(28-2)20(29-3)21(30-4)19(16)24/h7-10,12-13H,5-6,11H2,1-4H3,(H,25,26,27) |
| InChIKey | NQPFECINVFPXML-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|