C21H22N2O3S — CID 16557171
2,5-dimethoxy-N-[4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 16557171) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,5-dimethoxy-N-[4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16557171 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2,5-dimethoxy-N-[4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCc1ccc(-c2csc(NC(=O)c3cc(OC)ccc3OC)n2)cc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-4-5-14-6-8-15(9-7-14)18-13-27-21(22-18)23-20(24)17-12-16(25-2)10-11-19(17)26-3/h6-13H,4-5H2,1-3H3,(H,22,23,24) |
| InChIKey | MCLDLBQBKBYZJM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |