C18H15ClN2O3S — CID 16556958
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,5-dimethoxybenzamide (PubChem CID 16556958) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,5-dimethoxybenzamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 16556958 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2nc(-c3ccccc3Cl)cs2)c1 |
| InChI | InChI=1S/C18H15ClN2O3S/c1-23-11-7-8-16(24-2)13(9-11)17(22)21-18-20-15(10-25-18)12-5-3-4-6-14(12)19/h3-10H,1-2H3,(H,20,21,22) |
| InChIKey | WDXDLSVOHDFBCS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |