C18H13ClF2N2O3S — CID 2114849
2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4,5-difluorobenzamide (PubChem CID 2114849) has the molecular formula C18H13ClF2N2O3S and a molecular weight of 410.83 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 2114849 |
| Molecular Formula | C18H13ClF2N2O3S |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4,5-difluorobenzamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)c3cc(F)c(F)cc3Cl)n2)c1 |
| InChI | InChI=1S/C18H13ClF2N2O3S/c1-25-9-3-4-16(26-2)11(5-9)15-8-27-18(22-15)23-17(24)10-6-13(20)14(21)7-12(10)19/h3-8H,1-2H3,(H,22,23,24) |
| InChIKey | IYZPTCHVMJXAEM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|