C16H14N4O3S — CID 3914278
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide (PubChem CID 3914278) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 3914278 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)c3cnccn3)n2)c1 |
| InChI | InChI=1S/C16H14N4O3S/c1-22-10-3-4-14(23-2)11(7-10)13-9-24-16(19-13)20-15(21)12-8-17-5-6-18-12/h3-9H,1-2H3,(H,19,20,21) |
| InChIKey | UGHHDQIRXZMQCY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |