C29H25N5O6S2 — CID 3422188
2-N,6-N-bis[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyridine-2,6-dicarboxamide (PubChem CID 3422188) has the molecular formula C29H25N5O6S2 and a molecular weight of 603.68 g/mol. Its IUPAC name is 2-N,6-N-bis[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 3422188 |
| Molecular Formula | C29H25N5O6S2 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | 2-N,6-N-bis[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyridine-2,6-dicarboxamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)c3cccc(C(=O)Nc4nc(-c5cc(OC)ccc5OC)cs4)n3)n2)c1 |
| InChI | InChI=1S/C29H25N5O6S2/c1-37-16-8-10-24(39-3)18(12-16)22-14-41-28(31-22)33-26(35)20-6-5-7-21(30-20)27(36)34-29-32-23(15-42-29)19-13-17(38-2)9-11-25(19)40-4/h5-15H,1-4H3,(H,31,33,35)(H,32,34,36) |
| InChIKey | WIMFQJULJFLQJY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |