C22H24N2O4S — CID 3917091
3,4,5-trimethoxy-N-[4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 3917091) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3917091 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[4-(4-propylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCc1ccc(-c2csc(NC(=O)c3cc(OC)c(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-5-6-14-7-9-15(10-8-14)17-13-29-22(23-17)24-21(25)16-11-18(26-2)20(28-4)19(12-16)27-3/h7-13H,5-6H2,1-4H3,(H,23,24,25) |
| InChIKey | AEDNLTXBOGGWAO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |