C23H25N3O5S — CID 4000067
N-[3-[2-(butanoylamino)-1,3-thiazol-4-yl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 4000067) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[3-[2-(butanoylamino)-1,3-thiazol-4-yl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[2-(butanoylamino)-1,3-thiazol-4-yl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4000067 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[3-[2-(butanoylamino)-1,3-thiazol-4-yl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCCC(=O)Nc1nc(-c2cccc(NC(=O)c3cc(OC)c(OC)c(OC)c3)c2)cs1 |
| InChI | InChI=1S/C23H25N3O5S/c1-5-7-20(27)26-23-25-17(13-32-23)14-8-6-9-16(10-14)24-22(28)15-11-18(29-2)21(31-4)19(12-15)30-3/h6,8-13H,5,7H2,1-4H3,(H,24,28)(H,25,26,27) |
| InChIKey | SXKBANLITIZIGK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |