C25H23N3O2S — CID 3877402
4-ethyl-N-[3-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 3877402) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is 4-ethyl-N-[3-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 4-ethyl-N-[3-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 3877402 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 4-ethyl-N-[3-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | CCc1ccc(C(=O)Nc2cccc(-c3csc(Nc4ccccc4OC)n3)c2)cc1 |
| InChI | InChI=1S/C25H23N3O2S/c1-3-17-11-13-18(14-12-17)24(29)26-20-8-6-7-19(15-20)22-16-31-25(28-22)27-21-9-4-5-10-23(21)30-2/h4-16H,3H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | FCFYVJYAXOZDNM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |